C17H21Cl2FN2OS — CID 39177580
2,4-dichloro-5-fluoro-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]benzamide (PubChem CID 39177580) has the molecular formula C17H21Cl2FN2OS and a molecular weight of 391.34 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]benzamide |
|---|---|
| PubChem CID | 39177580 |
| Molecular Formula | C17H21Cl2FN2OS |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]benzamide |
| SMILES | O=C(NCC1(N2CCSCC2)CCCC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl2FN2OS/c18-13-10-14(19)15(20)9-12(13)16(23)21-11-17(3-1-2-4-17)22-5-7-24-8-6-22/h9-10H,1-8,11H2,(H,21,23) |
| InChIKey | OQZTXLSDLKFHGR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|