C19H29N3OS — CID 120646901
5-amino-2-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]benzamide (PubChem CID 120646901) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]benzamide.
| Compound Name | 5-amino-2-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 120646901 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 5-amino-2-methyl-N-[(1-thiomorpholin-4-ylcyclohexyl)methyl]benzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NCC1(N2CCSCC2)CCCCC1 |
| InChI | InChI=1S/C19H29N3OS/c1-15-5-6-16(20)13-17(15)18(23)21-14-19(7-3-2-4-8-19)22-9-11-24-12-10-22/h5-6,13H,2-4,7-12,14,20H2,1H3,(H,21,23) |
| InChIKey | OOTOBVXNLDUOKV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|