C22H35N3O5S — CID 46512676
5-(2-methoxyethylsulfamoyl)-2-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide (PubChem CID 46512676) has the molecular formula C22H35N3O5S and a molecular weight of 453.61 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfamoyl)-2-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide.
| Compound Name | 5-(2-methoxyethylsulfamoyl)-2-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 46512676 |
| Molecular Formula | C22H35N3O5S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 5-(2-methoxyethylsulfamoyl)-2-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)NCC2(N3CCOCC3)CCCCC2)c1 |
| InChI | InChI=1S/C22H35N3O5S/c1-18-6-7-19(31(27,28)24-10-13-29-2)16-20(18)21(26)23-17-22(8-4-3-5-9-22)25-11-14-30-15-12-25/h6-7,16,24H,3-5,8-15,17H2,1-2H3,(H,23,26) |
| InChIKey | ZRMWMINVKTXLQK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|