C22H31N3O5S — CID 55347344
N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide (PubChem CID 55347344) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 55347344 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)NCC(c2ccco2)N2CCCCC2)c1 |
| InChI | InChI=1S/C22H31N3O5S/c1-17-8-9-18(31(27,28)24-10-14-29-2)15-19(17)22(26)23-16-20(21-7-6-13-30-21)25-11-4-3-5-12-25/h6-9,13,15,20,24H,3-5,10-12,14,16H2,1-2H3,(H,23,26) |
| InChIKey | KGBMNMVNAHEJQL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|