C23H29N3O2 — CID 120637216
5-amino-N-[[1-[(3,4-dimethylphenyl)carbamoyl]cyclopentyl]methyl]-2-methylbenzamide (PubChem CID 120637216) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 5-amino-N-[[1-[(3,4-dimethylphenyl)carbamoyl]cyclopentyl]methyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[[1-[(3,4-dimethylphenyl)carbamoyl]cyclopentyl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 120637216 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 5-amino-N-[[1-[(3,4-dimethylphenyl)carbamoyl]cyclopentyl]methyl]-2-methylbenzamide |
| SMILES | Cc1ccc(NC(=O)C2(CNC(=O)c3cc(N)ccc3C)CCCC2)cc1C |
| InChI | InChI=1S/C23H29N3O2/c1-15-7-9-19(12-17(15)3)26-22(28)23(10-4-5-11-23)14-25-21(27)20-13-18(24)8-6-16(20)2/h6-9,12-13H,4-5,10-11,14,24H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | PUXGPJAKWBRRET-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|