C17H22BrN5O — CID 119394563
1-(3-bromophenyl)-N-(3-piperazin-1-ylpropyl)pyrazole-3-carboxamide (PubChem CID 119394563) has the molecular formula C17H22BrN5O and a molecular weight of 392.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(3-piperazin-1-ylpropyl)pyrazole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-(3-piperazin-1-ylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119394563 |
| Molecular Formula | C17H22BrN5O |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-(3-bromophenyl)-N-(3-piperazin-1-ylpropyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCCCN1CCNCC1)c1ccn(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C17H22BrN5O/c18-14-3-1-4-15(13-14)23-10-5-16(21-23)17(24)20-6-2-9-22-11-7-19-8-12-22/h1,3-5,10,13,19H,2,6-9,11-12H2,(H,20,24) |
| InChIKey | BEDSTGXWSSFCDB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|