C24H24N4O2 — CID 60524723
N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3,3-diphenylpropanamide (PubChem CID 60524723) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3,3-diphenylpropanamide.
| Compound Name | N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 60524723 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)NCCCn1nc2ccccn2c1=O |
| InChI | InChI=1S/C24H24N4O2/c29-23(18-21(19-10-3-1-4-11-19)20-12-5-2-6-13-20)25-15-9-17-28-24(30)27-16-8-7-14-22(27)26-28/h1-8,10-14,16,21H,9,15,17-18H2,(H,25,29) |
| InChIKey | JQNPMJPKDGIRRG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|