C18H29N5O2 — CID 95327050
(2R)-2-(diethylamino)-3-methyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]butanamide (PubChem CID 95327050) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2R)-2-(diethylamino)-3-methyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]butanamide.
| Compound Name | (2R)-2-(diethylamino)-3-methyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]butanamide |
|---|---|
| PubChem CID | 95327050 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (2R)-2-(diethylamino)-3-methyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]butanamide |
| SMILES | CCN(CC)[C@@H](C(=O)NCCCn1nc2ccccn2c1=O)C(C)C |
| InChI | InChI=1S/C18H29N5O2/c1-5-21(6-2)16(14(3)4)17(24)19-11-9-13-23-18(25)22-12-8-7-10-15(22)20-23/h7-8,10,12,14,16H,5-6,9,11,13H2,1-4H3,(H,19,24)/t16-/m1/s1 |
| InChIKey | RWIYOMLQVJFMKS-MRXNPFEDSA-N |
| XLogP | 1.37 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|