C20H21N7O3 — CID 51134974
N-[1-oxo-1-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]propan-2-yl]-1H-indazole-3-carboxamide (PubChem CID 51134974) has the molecular formula C20H21N7O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[1-oxo-1-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]propan-2-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[1-oxo-1-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]propan-2-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 51134974 |
| Molecular Formula | C20H21N7O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[1-oxo-1-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]propan-2-yl]-1H-indazole-3-carboxamide |
| SMILES | CC(NC(=O)c1n[nH]c2ccccc12)C(=O)NCCCn1nc2ccccn2c1=O |
| InChI | InChI=1S/C20H21N7O3/c1-13(22-19(29)17-14-7-2-3-8-15(14)23-24-17)18(28)21-10-6-12-27-20(30)26-11-5-4-9-16(26)25-27/h2-5,7-9,11,13H,6,10,12H2,1H3,(H,21,28)(H,22,29)(H,23,24) |
| InChIKey | FRAYNDDLIPVECS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|