C15H21N5O2 — CID 119509484
N-[1-[2-(ethylamino)ethylamino]-1-oxopropan-2-yl]-1H-indazole-3-carboxamide (PubChem CID 119509484) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[1-[2-(ethylamino)ethylamino]-1-oxopropan-2-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[1-[2-(ethylamino)ethylamino]-1-oxopropan-2-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 119509484 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[1-[2-(ethylamino)ethylamino]-1-oxopropan-2-yl]-1H-indazole-3-carboxamide |
| SMILES | CCNCCNC(=O)C(C)NC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C15H21N5O2/c1-3-16-8-9-17-14(21)10(2)18-15(22)13-11-6-4-5-7-12(11)19-20-13/h4-7,10,16H,3,8-9H2,1-2H3,(H,17,21)(H,18,22)(H,19,20) |
| InChIKey | WLAJABWEIDBJOB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|