C18H24N4O4 — CID 97247416
ethyl (3R)-4-[[(2S)-2-(1H-indazole-3-carbonylamino)propanoyl]amino]-3-methylbutanoate (PubChem CID 97247416) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl (3R)-4-[[(2S)-2-(1H-indazole-3-carbonylamino)propanoyl]amino]-3-methylbutanoate.
| Compound Name | ethyl (3R)-4-[[(2S)-2-(1H-indazole-3-carbonylamino)propanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 97247416 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl (3R)-4-[[(2S)-2-(1H-indazole-3-carbonylamino)propanoyl]amino]-3-methylbutanoate |
| SMILES | CCOC(=O)C[C@@H](C)CNC(=O)[C@H](C)NC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C18H24N4O4/c1-4-26-15(23)9-11(2)10-19-17(24)12(3)20-18(25)16-13-7-5-6-8-14(13)21-22-16/h5-8,11-12H,4,9-10H2,1-3H3,(H,19,24)(H,20,25)(H,21,22)/t11-,12+/m1/s1 |
| InChIKey | FEBPLFNWFBZQLW-NEPJUHHUSA-N |
| XLogP | 1.39 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |