C23H23N5O4 — CID 55862998
N-[1-oxo-1-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]-3-phenylpropan-2-yl]furan-2-carboxamide (PubChem CID 55862998) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[1-oxo-1-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]-3-phenylpropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-oxo-1-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]-3-phenylpropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55862998 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[1-oxo-1-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]-3-phenylpropan-2-yl]furan-2-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)NCCCn1nc2ccccn2c1=O)c1ccco1 |
| InChI | InChI=1S/C23H23N5O4/c29-21(24-12-7-14-28-23(31)27-13-5-4-11-20(27)26-28)18(16-17-8-2-1-3-9-17)25-22(30)19-10-6-15-32-19/h1-6,8-11,13,15,18H,7,12,14,16H2,(H,24,29)(H,25,30) |
| InChIKey | JFLWRIJDULAOCZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|