C18H20N4O2S — CID 55865445
2-(2-methylphenyl)sulfanyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]acetamide (PubChem CID 55865445) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-(2-methylphenyl)sulfanyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]acetamide.
| Compound Name | 2-(2-methylphenyl)sulfanyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 55865445 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-(2-methylphenyl)sulfanyl-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]acetamide |
| SMILES | Cc1ccccc1SCC(=O)NCCCn1nc2ccccn2c1=O |
| InChI | InChI=1S/C18H20N4O2S/c1-14-7-2-3-8-15(14)25-13-17(23)19-10-6-12-22-18(24)21-11-5-4-9-16(21)20-22/h2-5,7-9,11H,6,10,12-13H2,1H3,(H,19,23) |
| InChIKey | WBYKTYBSOXEBCW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|