C12H16ClN3O — CID 62229478
2-(6-chlorohexyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 62229478) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-(6-chlorohexyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-(6-chlorohexyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 62229478 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-(6-chlorohexyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=c1n(CCCCCCCl)nc2ccccn12 |
| InChI | InChI=1S/C12H16ClN3O/c13-8-4-1-2-5-10-16-12(17)15-9-6-3-7-11(15)14-16/h3,6-7,9H,1-2,4-5,8,10H2 |
| InChIKey | BGYKEFACODHGAO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|