C10H9N3O — CID 63656448
2-but-3-ynyl-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 63656448) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 2-but-3-ynyl-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-but-3-ynyl-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 63656448 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 2-but-3-ynyl-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | C#CCCn1nc2ccccn2c1=O |
| InChI | InChI=1S/C10H9N3O/c1-2-3-8-13-10(14)12-7-5-4-6-9(12)11-13/h1,4-7H,3,8H2 |
| InChIKey | MHTCFONYEOOHRQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|