C12H17N3O — CID 116618637
2-(2-ethylbutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 116618637) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(2-ethylbutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-(2-ethylbutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 116618637 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-(2-ethylbutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCC(CC)Cn1nc2ccccn2c1=O |
| InChI | InChI=1S/C12H17N3O/c1-3-10(4-2)9-15-12(16)14-8-6-5-7-11(14)13-15/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | RQUOBAFVDUCJGX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |