C16H13FN4O — CID 66598017
2-[4-[6-(fluoromethyl)-2-pyridinyl]but-3-ynyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 66598017) has the molecular formula C16H13FN4O and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-[4-[6-(fluoromethyl)-2-pyridinyl]but-3-ynyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[4-[6-(fluoromethyl)-2-pyridinyl]but-3-ynyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 66598017 |
| Molecular Formula | C16H13FN4O |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[4-[6-(fluoromethyl)-2-pyridinyl]but-3-ynyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=c1n(CCC#Cc2cccc(CF)n2)nc2ccccn12 |
| InChI | InChI=1S/C16H13FN4O/c17-12-14-8-5-7-13(18-14)6-1-4-11-21-16(22)20-10-3-2-9-15(20)19-21/h2-3,5,7-10H,4,11-12H2 |
| InChIKey | CIQCIMSBGGWEDN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|