C15H14FN3OS — CID 42955328
2-[2-[(3-fluorophenyl)methylsulfanyl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 42955328) has the molecular formula C15H14FN3OS and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[2-[(3-fluorophenyl)methylsulfanyl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-[(3-fluorophenyl)methylsulfanyl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 42955328 |
| Molecular Formula | C15H14FN3OS |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-[2-[(3-fluorophenyl)methylsulfanyl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=c1n(CCSCc2cccc(F)c2)nc2ccccn12 |
| InChI | InChI=1S/C15H14FN3OS/c16-13-5-3-4-12(10-13)11-21-9-8-19-15(20)18-7-2-1-6-14(18)17-19/h1-7,10H,8-9,11H2 |
| InChIKey | ZVDYBZAMZKSNJG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|