C22H19Cl2F3N4O4 — CID 19326077
N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-4-[(2-chloro-4-nitrophenoxy)methyl]benzamide (PubChem CID 19326077) has the molecular formula C22H19Cl2F3N4O4 and a molecular weight of 531.32 g/mol. Its IUPAC name is N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-4-[(2-chloro-4-nitrophenoxy)methyl]benzamide.
| Compound Name | N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-4-[(2-chloro-4-nitrophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19326077 |
| Molecular Formula | C22H19Cl2F3N4O4 |
| Molecular Weight | 531.32 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-4-[(2-chloro-4-nitrophenoxy)methyl]benzamide |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CCCNC(=O)c1ccc(COc2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C22H19Cl2F3N4O4/c1-13-19(24)20(22(25,26)27)29-30(13)10-2-9-28-21(32)15-5-3-14(4-6-15)12-35-18-8-7-16(31(33)34)11-17(18)23/h3-8,11H,2,9-10,12H2,1H3,(H,28,32) |
| InChIKey | OFOPRGCHGYLWTK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.32 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|