C22H21ClF3N3O5 — CID 19326054
methyl 4-[[5-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]furan-2-yl]methoxy]benzoate (PubChem CID 19326054) has the molecular formula C22H21ClF3N3O5 and a molecular weight of 499.87 g/mol. Its IUPAC name is methyl 4-[[5-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]furan-2-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[5-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]furan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 19326054 |
| Molecular Formula | C22H21ClF3N3O5 |
| Molecular Weight | 499.87 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | methyl 4-[[5-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propylcarbamoyl]furan-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2ccc(C(=O)NCCCn3nc(C(F)(F)F)c(Cl)c3C)o2)cc1 |
| InChI | InChI=1S/C22H21ClF3N3O5/c1-13-18(23)19(22(24,25)26)28-29(13)11-3-10-27-20(30)17-9-8-16(34-17)12-33-15-6-4-14(5-7-15)21(31)32-2/h4-9H,3,10-12H2,1-2H3,(H,27,30) |
| InChIKey | KNDWPVGYNMZFCW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|