C26H23ClF3N3O3 — CID 19324002
N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide (PubChem CID 19324002) has the molecular formula C26H23ClF3N3O3 and a molecular weight of 517.94 g/mol. Its IUPAC name is N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19324002 |
| Molecular Formula | C26H23ClF3N3O3 |
| Molecular Weight | 517.94 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
| SMILES | O=C(NCCCn1nc(C(F)(F)F)c(Cl)c1C1CC1)c1ccc(COc2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C26H23ClF3N3O3/c27-22-23(17-6-7-17)33(32-24(22)26(28,29)30)13-3-12-31-25(34)21-11-10-20(36-21)15-35-19-9-8-16-4-1-2-5-18(16)14-19/h1-2,4-5,8-11,14,17H,3,6-7,12-13,15H2,(H,31,34) |
| InChIKey | FYGPMAFOGXEOOF-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.94 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|