C16H18ClN3O — CID 19327940
(E)-3-(2-chlorophenyl)-N-[3-(4-methylpyrazol-1-yl)propyl]prop-2-enamide (PubChem CID 19327940) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[3-(4-methylpyrazol-1-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[3-(4-methylpyrazol-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 19327940 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[3-(4-methylpyrazol-1-yl)propyl]prop-2-enamide |
| SMILES | Cc1cnn(CCCNC(=O)/C=C/c2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H18ClN3O/c1-13-11-19-20(12-13)10-4-9-18-16(21)8-7-14-5-2-3-6-15(14)17/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,18,21)/b8-7+ |
| InChIKey | HIJFOFNVOCPZMG-BQYQJAHWSA-N |
| XLogP | 3.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|