C22H23N3O — CID 19327946
(Z)-N-[3-(4-methylpyrazol-1-yl)propyl]-2,3-diphenylprop-2-enamide (PubChem CID 19327946) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is (Z)-N-[3-(4-methylpyrazol-1-yl)propyl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[3-(4-methylpyrazol-1-yl)propyl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 19327946 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (Z)-N-[3-(4-methylpyrazol-1-yl)propyl]-2,3-diphenylprop-2-enamide |
| SMILES | Cc1cnn(CCCNC(=O)/C(=C\c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H23N3O/c1-18-16-24-25(17-18)14-8-13-23-22(26)21(20-11-6-3-7-12-20)15-19-9-4-2-5-10-19/h2-7,9-12,15-17H,8,13-14H2,1H3,(H,23,26)/b21-15- |
| InChIKey | QLLQJRDGJGVOFB-QNGOZBTKSA-N |
| XLogP | 3.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|