C18H18ClNOS — CID 2884623
3-(2-chlorophenyl)-N-[2-(4-methylphenyl)sulfanylethyl]prop-2-enamide (PubChem CID 2884623) has the molecular formula C18H18ClNOS and a molecular weight of 331.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[2-(4-methylphenyl)sulfanylethyl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[2-(4-methylphenyl)sulfanylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 2884623 |
| Molecular Formula | C18H18ClNOS |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[2-(4-methylphenyl)sulfanylethyl]prop-2-enamide |
| SMILES | Cc1ccc(SCCNC(=O)C=Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H18ClNOS/c1-14-6-9-16(10-7-14)22-13-12-20-18(21)11-8-15-4-2-3-5-17(15)19/h2-11H,12-13H2,1H3,(H,20,21) |
| InChIKey | XNFFPAWMSVKDAH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|