C18H20ClN3O2 — CID 66928257
3-(2-chlorophenyl)-N-[1-(5-oxohexyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 66928257) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[1-(5-oxohexyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[1-(5-oxohexyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 66928257 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[1-(5-oxohexyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | CC(=O)CCCCn1cc(NC(=O)C=Cc2ccccc2Cl)cn1 |
| InChI | InChI=1S/C18H20ClN3O2/c1-14(23)6-4-5-11-22-13-16(12-20-22)21-18(24)10-9-15-7-2-3-8-17(15)19/h2-3,7-10,12-13H,4-6,11H2,1H3,(H,21,24) |
| InChIKey | APOSBMCOVHDIDR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|