C19H20F3N3O2 — CID 66928315
(Z)-N-[1-(5-oxohexyl)pyrazol-4-yl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 66928315) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is (Z)-N-[1-(5-oxohexyl)pyrazol-4-yl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-N-[1-(5-oxohexyl)pyrazol-4-yl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 66928315 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (Z)-N-[1-(5-oxohexyl)pyrazol-4-yl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC(=O)CCCCn1cc(NC(=O)/C=C\c2ccccc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H20F3N3O2/c1-14(26)6-4-5-11-25-13-16(12-23-25)24-18(27)10-9-15-7-2-3-8-17(15)19(20,21)22/h2-3,7-10,12-13H,4-6,11H2,1H3,(H,24,27)/b10-9- |
| InChIKey | KXUOTBBJEJNQTA-KTKRTIGZSA-N |
| XLogP | 4.31 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|