C19H23N5O — CID 51095084
(E)-3-(2-cyanophenyl)-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]prop-2-enamide (PubChem CID 51095084) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is (E)-3-(2-cyanophenyl)-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-cyanophenyl)-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 51095084 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (E)-3-(2-cyanophenyl)-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]prop-2-enamide |
| SMILES | CCN(CC)CCn1cc(NC(=O)/C=C/c2ccccc2C#N)cn1 |
| InChI | InChI=1S/C19H23N5O/c1-3-23(4-2)11-12-24-15-18(14-21-24)22-19(25)10-9-16-7-5-6-8-17(16)13-20/h5-10,14-15H,3-4,11-12H2,1-2H3,(H,22,25)/b10-9+ |
| InChIKey | IEZRRJXWEXEMJU-MDZDMXLPSA-N |
| XLogP | 2.75 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|