C13H25N5O — CID 62638227
N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-2-(methylamino)propanamide (PubChem CID 62638227) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-2-(methylamino)propanamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 62638227 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-2-(methylamino)propanamide |
| SMILES | CCN(CC)CCn1cc(NC(=O)C(C)NC)cn1 |
| InChI | InChI=1S/C13H25N5O/c1-5-17(6-2)7-8-18-10-12(9-15-18)16-13(19)11(3)14-4/h9-11,14H,5-8H2,1-4H3,(H,16,19) |
| InChIKey | GNWBGQUXPQCVIY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |