C21H31N5O2 — CID 47926908
3-acetamido-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-3-(4-methylphenyl)propanamide (PubChem CID 47926908) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-acetamido-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-3-(4-methylphenyl)propanamide.
| Compound Name | 3-acetamido-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 47926908 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 3-acetamido-N-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-3-(4-methylphenyl)propanamide |
| SMILES | CCN(CC)CCn1cc(NC(=O)CC(NC(C)=O)c2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C21H31N5O2/c1-5-25(6-2)11-12-26-15-19(14-22-26)24-21(28)13-20(23-17(4)27)18-9-7-16(3)8-10-18/h7-10,14-15,20H,5-6,11-13H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | HZPYVZXUXSQGFQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |