C17H20ClN3O3 — CID 66929105
(2-chlorophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate (PubChem CID 66929105) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate.
| Compound Name | (2-chlorophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 66929105 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (2-chlorophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate |
| SMILES | CC(=O)CCCCn1cc(NC(=O)OCc2ccccc2Cl)cn1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-13(22)6-4-5-9-21-11-15(10-19-21)20-17(23)24-12-14-7-2-3-8-16(14)18/h2-3,7-8,10-11H,4-6,9,12H2,1H3,(H,20,23) |
| InChIKey | AVUSLAQOXNWAQZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|