C17H19ClFN3O3 — CID 66929108
(2-chloro-4-fluorophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate (PubChem CID 66929108) has the molecular formula C17H19ClFN3O3 and a molecular weight of 367.81 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate.
| Compound Name | (2-chloro-4-fluorophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 66929108 |
| Molecular Formula | C17H19ClFN3O3 |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (2-chloro-4-fluorophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate |
| SMILES | CC(=O)CCCCn1cc(NC(=O)OCc2ccc(F)cc2Cl)cn1 |
| InChI | InChI=1S/C17H19ClFN3O3/c1-12(23)4-2-3-7-22-10-15(9-20-22)21-17(24)25-11-13-5-6-14(19)8-16(13)18/h5-6,8-10H,2-4,7,11H2,1H3,(H,21,24) |
| InChIKey | USTKPHKMBSNZDP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|