C17H20BrN3O3 — CID 66928302
(4-bromophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate (PubChem CID 66928302) has the molecular formula C17H20BrN3O3 and a molecular weight of 394.27 g/mol. Its IUPAC name is (4-bromophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate.
| Compound Name | (4-bromophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 66928302 |
| Molecular Formula | C17H20BrN3O3 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | (4-bromophenyl)methyl N-[1-(5-oxohexyl)pyrazol-4-yl]carbamate |
| SMILES | CC(=O)CCCCn1cc(NC(=O)OCc2ccc(Br)cc2)cn1 |
| InChI | InChI=1S/C17H20BrN3O3/c1-13(22)4-2-3-9-21-11-16(10-19-21)20-17(23)24-12-14-5-7-15(18)8-6-14/h5-8,10-11H,2-4,9,12H2,1H3,(H,20,23) |
| InChIKey | GYEIQZXDPSRFOG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|