C19H25F2N3O2 — CID 66928994
(2,5-dimethylphenyl)methyl N-[1-(5,5-difluorohexyl)pyrazol-4-yl]carbamate (PubChem CID 66928994) has the molecular formula C19H25F2N3O2 and a molecular weight of 365.42 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl N-[1-(5,5-difluorohexyl)pyrazol-4-yl]carbamate.
| Compound Name | (2,5-dimethylphenyl)methyl N-[1-(5,5-difluorohexyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 66928994 |
| Molecular Formula | C19H25F2N3O2 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (2,5-dimethylphenyl)methyl N-[1-(5,5-difluorohexyl)pyrazol-4-yl]carbamate |
| SMILES | Cc1ccc(C)c(COC(=O)Nc2cnn(CCCCC(C)(F)F)c2)c1 |
| InChI | InChI=1S/C19H25F2N3O2/c1-14-6-7-15(2)16(10-14)13-26-18(25)23-17-11-22-24(12-17)9-5-4-8-19(3,20)21/h6-7,10-12H,4-5,8-9,13H2,1-3H3,(H,23,25) |
| InChIKey | JMSWCNXPXVJJCP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|