C21H24F2N4O3 — CID 66928540
N-[1-(5,5-difluorohexyl)pyrazol-4-yl]-5-(4-methoxyphenyl)-2-methyl-1,3-oxazole-4-carboxamide (PubChem CID 66928540) has the molecular formula C21H24F2N4O3 and a molecular weight of 418.44 g/mol. Its IUPAC name is N-[1-(5,5-difluorohexyl)pyrazol-4-yl]-5-(4-methoxyphenyl)-2-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[1-(5,5-difluorohexyl)pyrazol-4-yl]-5-(4-methoxyphenyl)-2-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 66928540 |
| Molecular Formula | C21H24F2N4O3 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[1-(5,5-difluorohexyl)pyrazol-4-yl]-5-(4-methoxyphenyl)-2-methyl-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(-c2oc(C)nc2C(=O)Nc2cnn(CCCCC(C)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H24F2N4O3/c1-14-25-18(19(30-14)15-6-8-17(29-3)9-7-15)20(28)26-16-12-24-27(13-16)11-5-4-10-21(2,22)23/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,26,28) |
| InChIKey | JVRAPULPCWMQIX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|