C18H23F2N3O2 — CID 66928021
(2-methylphenyl)methyl N-[1-(5,5-difluorohexyl)pyrazol-3-yl]carbamate (PubChem CID 66928021) has the molecular formula C18H23F2N3O2 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2-methylphenyl)methyl N-[1-(5,5-difluorohexyl)pyrazol-3-yl]carbamate.
| Compound Name | (2-methylphenyl)methyl N-[1-(5,5-difluorohexyl)pyrazol-3-yl]carbamate |
|---|---|
| PubChem CID | 66928021 |
| Molecular Formula | C18H23F2N3O2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2-methylphenyl)methyl N-[1-(5,5-difluorohexyl)pyrazol-3-yl]carbamate |
| SMILES | Cc1ccccc1COC(=O)Nc1ccn(CCCCC(C)(F)F)n1 |
| InChI | InChI=1S/C18H23F2N3O2/c1-14-7-3-4-8-15(14)13-25-17(24)21-16-9-12-23(22-16)11-6-5-10-18(2,19)20/h3-4,7-9,12H,5-6,10-11,13H2,1-2H3,(H,21,22,24) |
| InChIKey | SFDHXEFSYVOGMY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|