C19H23F2N3O — CID 66929176
N-[1-(5,5-difluorohexyl)pyrazol-3-yl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 66929176) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[1-(5,5-difluorohexyl)pyrazol-3-yl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-[1-(5,5-difluorohexyl)pyrazol-3-yl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 66929176 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[1-(5,5-difluorohexyl)pyrazol-3-yl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)Nc2ccn(CCCCC(C)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H23F2N3O/c1-15-5-7-16(8-6-15)9-10-18(25)22-17-11-14-24(23-17)13-4-3-12-19(2,20)21/h5-11,14H,3-4,12-13H2,1-2H3,(H,22,23,25) |
| InChIKey | UQTZACFCUOZEHM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|