C18H19Cl2F2N3O — CID 66929003
3-(2,3-dichlorophenyl)-N-[1-(5,5-difluorohexyl)pyrazol-3-yl]prop-2-enamide (PubChem CID 66929003) has the molecular formula C18H19Cl2F2N3O and a molecular weight of 402.27 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-N-[1-(5,5-difluorohexyl)pyrazol-3-yl]prop-2-enamide.
| Compound Name | 3-(2,3-dichlorophenyl)-N-[1-(5,5-difluorohexyl)pyrazol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 66929003 |
| Molecular Formula | C18H19Cl2F2N3O |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-N-[1-(5,5-difluorohexyl)pyrazol-3-yl]prop-2-enamide |
| SMILES | CC(F)(F)CCCCn1ccc(NC(=O)C=Cc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C18H19Cl2F2N3O/c1-18(21,22)10-2-3-11-25-12-9-15(24-25)23-16(26)8-7-13-5-4-6-14(19)17(13)20/h4-9,12H,2-3,10-11H2,1H3,(H,23,24,26) |
| InChIKey | PAQBDHPKDMCNLP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|