C20H17Cl2N3O2 — CID 47789670
(E)-3-(2,3-dichlorophenyl)-N-[2-(2-imidazol-1-ylethoxy)phenyl]prop-2-enamide (PubChem CID 47789670) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-[2-(2-imidazol-1-ylethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-[2-(2-imidazol-1-ylethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 47789670 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-[2-(2-imidazol-1-ylethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)Nc1ccccc1OCCn1ccnc1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c21-16-5-3-4-15(20(16)22)8-9-19(26)24-17-6-1-2-7-18(17)27-13-12-25-11-10-23-14-25/h1-11,14H,12-13H2,(H,24,26)/b9-8+ |
| InChIKey | FDLRIIHTWZAUQG-CMDGGOBGSA-N |
| XLogP | 4.92 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|