C20H19Cl2N5O — CID 56573444
(E)-N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-3-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 56573444) has the molecular formula C20H19Cl2N5O and a molecular weight of 416.31 g/mol. Its IUPAC name is (E)-N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-3-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-3-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 56573444 |
| Molecular Formula | C20H19Cl2N5O |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (E)-N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-3-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1cc(NC(=O)/C=C/c2cccc(Cl)c2Cl)n(-c2ncccn2)n1 |
| InChI | InChI=1S/C20H19Cl2N5O/c1-20(2,3)15-12-16(27(26-15)19-23-10-5-11-24-19)25-17(28)9-8-13-6-4-7-14(21)18(13)22/h4-12H,1-3H3,(H,25,28)/b9-8+ |
| InChIKey | PSWKHKRQIRZFJM-CMDGGOBGSA-N |
| XLogP | 4.92 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|