C21H20F3N5O — CID 56570299
(Z)-N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-4,4,4-trifluoro-3-phenylbut-2-enamide (PubChem CID 56570299) has the molecular formula C21H20F3N5O and a molecular weight of 415.42 g/mol. Its IUPAC name is (Z)-N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-4,4,4-trifluoro-3-phenylbut-2-enamide.
| Compound Name | (Z)-N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-4,4,4-trifluoro-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 56570299 |
| Molecular Formula | C21H20F3N5O |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (Z)-N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-4,4,4-trifluoro-3-phenylbut-2-enamide |
| SMILES | CC(C)(C)c1cc(NC(=O)/C=C(/c2ccccc2)C(F)(F)F)n(-c2ncccn2)n1 |
| InChI | InChI=1S/C21H20F3N5O/c1-20(2,3)16-13-17(29(28-16)19-25-10-7-11-26-19)27-18(30)12-15(21(22,23)24)14-8-5-4-6-9-14/h4-13H,1-3H3,(H,27,30)/b15-12- |
| InChIKey | IYNLBMLYPAMXPN-QINSGFPZSA-N |
| XLogP | 4.54 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|