C20H22ClN5OS — CID 56570330
N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-2-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 56570330) has the molecular formula C20H22ClN5OS and a molecular weight of 415.95 g/mol. Its IUPAC name is N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-2-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-2-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 56570330 |
| Molecular Formula | C20H22ClN5OS |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-(3-tert-butyl-1-pyrimidin-2-ylpyrazol-5-yl)-2-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)Nc1cc(C(C)(C)C)nn1-c1ncccn1 |
| InChI | InChI=1S/C20H22ClN5OS/c1-13(28-15-8-6-14(21)7-9-15)18(27)24-17-12-16(20(2,3)4)25-26(17)19-22-10-5-11-23-19/h5-13H,1-4H3,(H,24,27) |
| InChIKey | GZJHXOFSRNMOSR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |