C26H27ClN2O2S — CID 46778372
4-tert-butyl-N-[3-[2-(4-chlorophenyl)sulfanylpropanoylamino]phenyl]benzamide (PubChem CID 46778372) has the molecular formula C26H27ClN2O2S and a molecular weight of 467.03 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[2-(4-chlorophenyl)sulfanylpropanoylamino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[2-(4-chlorophenyl)sulfanylpropanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 46778372 |
| Molecular Formula | C26H27ClN2O2S |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 4-tert-butyl-N-[3-[2-(4-chlorophenyl)sulfanylpropanoylamino]phenyl]benzamide |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)Nc1cccc(NC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C26H27ClN2O2S/c1-17(32-23-14-12-20(27)13-15-23)24(30)28-21-6-5-7-22(16-21)29-25(31)18-8-10-19(11-9-18)26(2,3)4/h5-17H,1-4H3,(H,28,30)(H,29,31) |
| InChIKey | RJCTVHXNMFGSJF-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |