C23H17F3N2O2 — CID 56506611
N-[2-[[(E)-4,4,4-trifluoro-3-phenylbut-2-enoyl]amino]phenyl]benzamide (PubChem CID 56506611) has the molecular formula C23H17F3N2O2 and a molecular weight of 410.40 g/mol. Its IUPAC name is N-[2-[[(E)-4,4,4-trifluoro-3-phenylbut-2-enoyl]amino]phenyl]benzamide.
| Compound Name | N-[2-[[(E)-4,4,4-trifluoro-3-phenylbut-2-enoyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 56506611 |
| Molecular Formula | C23H17F3N2O2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-[2-[[(E)-4,4,4-trifluoro-3-phenylbut-2-enoyl]amino]phenyl]benzamide |
| SMILES | O=C(/C=C(\c1ccccc1)C(F)(F)F)Nc1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H17F3N2O2/c24-23(25,26)18(16-9-3-1-4-10-16)15-21(29)27-19-13-7-8-14-20(19)28-22(30)17-11-5-2-6-12-17/h1-15H,(H,27,29)(H,28,30)/b18-15+ |
| InChIKey | NWZOJJNSKDVING-OBGWFSINSA-N |
| XLogP | 5.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|