C18H12ClF3N4O — CID 56508385
(E)-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide (PubChem CID 56508385) has the molecular formula C18H12ClF3N4O and a molecular weight of 392.77 g/mol. Its IUPAC name is (E)-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide.
| Compound Name | (E)-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 56508385 |
| Molecular Formula | C18H12ClF3N4O |
| Molecular Weight | 392.77 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (E)-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide |
| SMILES | O=C(/C=C(\c1ccccc1)C(F)(F)F)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C18H12ClF3N4O/c19-13-6-7-16(26-11-23-10-24-26)15(8-13)25-17(27)9-14(18(20,21)22)12-4-2-1-3-5-12/h1-11H,(H,25,27)/b14-9+ |
| InChIKey | KRRZCFLRFCZLDT-NTEUORMPSA-N |
| XLogP | 4.51 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|