C22H20ClF3N2O2 — CID 56508527
(E)-N-[5-chloro-2-(piperidine-1-carbonyl)phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide (PubChem CID 56508527) has the molecular formula C22H20ClF3N2O2 and a molecular weight of 436.86 g/mol. Its IUPAC name is (E)-N-[5-chloro-2-(piperidine-1-carbonyl)phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide.
| Compound Name | (E)-N-[5-chloro-2-(piperidine-1-carbonyl)phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 56508527 |
| Molecular Formula | C22H20ClF3N2O2 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (E)-N-[5-chloro-2-(piperidine-1-carbonyl)phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide |
| SMILES | O=C(/C=C(\c1ccccc1)C(F)(F)F)Nc1cc(Cl)ccc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H20ClF3N2O2/c23-16-9-10-17(21(30)28-11-5-2-6-12-28)19(13-16)27-20(29)14-18(22(24,25)26)15-7-3-1-4-8-15/h1,3-4,7-10,13-14H,2,5-6,11-12H2,(H,27,29)/b18-14+ |
| InChIKey | LQJRVNJZYQPXMK-NBVRZTHBSA-N |
| XLogP | 5.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|