C19H18Cl2N2O2S — CID 112760310
2-(4-chlorophenyl)sulfanyl-N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]acetamide (PubChem CID 112760310) has the molecular formula C19H18Cl2N2O2S and a molecular weight of 409.34 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 112760310 |
| Molecular Formula | C19H18Cl2N2O2S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1cc(Cl)ccc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C19H18Cl2N2O2S/c20-13-3-6-15(7-4-13)26-12-18(24)22-17-11-14(21)5-8-16(17)19(25)23-9-1-2-10-23/h3-8,11H,1-2,9-10,12H2,(H,22,24) |
| InChIKey | BSFDCPXPNNQTOM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |