C25H24ClN3O2S — CID 112800932
N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[2-(pyrrolidine-1-carbonyl)anilino]acetamide (PubChem CID 112800932) has the molecular formula C25H24ClN3O2S and a molecular weight of 466.01 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[2-(pyrrolidine-1-carbonyl)anilino]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[2-(pyrrolidine-1-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 112800932 |
| Molecular Formula | C25H24ClN3O2S |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[2-(pyrrolidine-1-carbonyl)anilino]acetamide |
| SMILES | O=C(CNc1ccccc1C(=O)N1CCCC1)Nc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClN3O2S/c26-18-11-13-19(14-12-18)32-23-10-4-3-9-22(23)28-24(30)17-27-21-8-2-1-7-20(21)25(31)29-15-5-6-16-29/h1-4,7-14,27H,5-6,15-17H2,(H,28,30) |
| InChIKey | ZMAJPBBPJMDKFJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |