C20H19Cl2N3O — CID 46088066
N-(3-tert-butyl-1-phenylpyrazol-5-yl)-2,3-dichlorobenzamide (PubChem CID 46088066) has the molecular formula C20H19Cl2N3O and a molecular weight of 388.30 g/mol. Its IUPAC name is N-(3-tert-butyl-1-phenylpyrazol-5-yl)-2,3-dichlorobenzamide.
| Compound Name | N-(3-tert-butyl-1-phenylpyrazol-5-yl)-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 46088066 |
| Molecular Formula | C20H19Cl2N3O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-(3-tert-butyl-1-phenylpyrazol-5-yl)-2,3-dichlorobenzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2cccc(Cl)c2Cl)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H19Cl2N3O/c1-20(2,3)16-12-17(25(24-16)13-8-5-4-6-9-13)23-19(26)14-10-7-11-15(21)18(14)22/h4-12H,1-3H3,(H,23,26) |
| InChIKey | SGUUQHMJBJXLMU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |