C18H16ClN3O — CID 138993742
2-chloro-3-methyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzamide (PubChem CID 138993742) has the molecular formula C18H16ClN3O and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-chloro-3-methyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzamide.
| Compound Name | 2-chloro-3-methyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 138993742 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-chloro-3-methyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(C)c2Cl)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H16ClN3O/c1-12-7-6-10-15(17(12)19)18(23)20-16-11-13(2)21-22(16)14-8-4-3-5-9-14/h3-11H,1-2H3,(H,20,23) |
| InChIKey | JABZUTIFLFKYMR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |