C18H24ClN3O — CID 42730449
N-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-chloro-2,2-dimethylpropanamide (PubChem CID 42730449) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is N-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-chloro-2,2-dimethylpropanamide.
| Compound Name | N-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-chloro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42730449 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-(3-tert-butyl-1-phenylpyrazol-5-yl)-3-chloro-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1 |
| InChI | InChI=1S/C18H24ClN3O/c1-17(2,3)14-11-15(20-16(23)18(4,5)12-19)22(21-14)13-9-7-6-8-10-13/h6-11H,12H2,1-5H3,(H,20,23) |
| InChIKey | WXCWQXOARXOHLP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|